Sonzaschool
Rudi

Sekondari ya Juu · Kidato cha Tano

Advanced Mathematics 1

Factor Formulae

takriban dakika 6 kusoma

Mada za sehemu hiiTrigonometryMada 7

Factor Formulae

Factor formulae are used to factorize the sum and difference of two trigonometric terms and to express a product as a sum or difference. They are derived from the compound angle formulae.

Derivation of factor formulae

From the compound angle formulae for sine:

sin(A+B)=sinAcosB+cosAsinB\sin(A + B) = \sin A \cos B + \cos A \sin B

sin(AB)=sinAcosBcosAsinB\sin(A - B) = \sin A \cos B - \cos A \sin B

Adding the two equations gives:

sin(A+B)+sin(AB)=2sinAcosB(i)\sin(A + B) + \sin(A - B) = 2\sin A \cos B \quad \text{(i)}

Subtracting the two equations gives:

sin(A+B)sin(AB)=2cosAsinB(ii)\sin(A + B) - \sin(A - B) = 2\cos A \sin B \quad \text{(ii)}

From the compound angle formulae for cosine:

cos(A+B)=cosAcosBsinAsinB\cos(A + B) = \cos A \cos B - \sin A \sin B

cos(AB)=cosAcosB+sinAsinB\cos(A - B) = \cos A \cos B + \sin A \sin B

Adding the two equations gives:

cos(A+B)+cos(AB)=2cosAcosB(iii)\cos(A + B) + \cos(A - B) = 2\cos A \cos B \quad \text{(iii)}

Subtracting the two equations gives:

cos(AB)cos(A+B)=2sinAsinB(iv)\cos(A - B) - \cos(A + B) = 2\sin A \sin B \quad \text{(iv)}

Let P=A+BP = A + B and Q=ABQ = A - B. Then:

P+Q=2A, so A=P+Q2P + Q = 2A, \text{ so } A = \frac{P + Q}{2}

PQ=2B, so B=PQ2P - Q = 2B, \text{ so } B = \frac{P - Q}{2}

Substituting these into equations (i), (ii), (iii), and (iv) gives the factor formulae:

sinP+sinQ=2sin(P+Q2)cos(PQ2)(7.8)\sin P + \sin Q = 2\sin\left(\frac{P + Q}{2}\right)\cos\left(\frac{P - Q}{2}\right) \quad (7.8)

sinPsinQ=2cos(P+Q2)sin(PQ2)(7.9)\sin P - \sin Q = 2\cos\left(\frac{P + Q}{2}\right)\sin\left(\frac{P - Q}{2}\right) \quad (7.9)

cosP+cosQ=2cos(P+Q2)cos(PQ2)(7.10)\cos P + \cos Q = 2\cos\left(\frac{P + Q}{2}\right)\cos\left(\frac{P - Q}{2}\right) \quad (7.10)

cosQcosP=2sin(P+Q2)sin(PQ2)(7.11)\cos Q - \cos P = 2\sin\left(\frac{P + Q}{2}\right)\sin\left(\frac{P - Q}{2}\right) \quad (7.11)

Note the change in sign and order in this formula compared to the source material.

Example 1

Prove that sinθ+sin2θ+sin3θ=sin2θ(2cosθ+1)\sin\theta + \sin 2\theta + \sin 3\theta = \sin 2\theta(2\cos\theta + 1).

Solution:

Consider the left-hand side:

sinθ+sin2θ+sin3θ=(sin3θ+sinθ)+sin2θ\sin\theta + \sin 2\theta + \sin 3\theta = (\sin 3\theta + \sin\theta) + \sin 2\theta

=2sin(3θ+θ2)cos(3θθ2)+sin2θ= 2\sin\left(\frac{3\theta + \theta}{2}\right)\cos\left(\frac{3\theta - \theta}{2}\right) + \sin 2\theta

=2sin2θcosθ+sin2θ= 2\sin 2\theta \cos\theta + \sin 2\theta

=sin2θ(2cosθ+1)= \sin 2\theta(2\cos\theta + 1)

Therefore, sinθ+sin2θ+sin3θ=sin2θ(2cosθ+1)\sin\theta + \sin 2\theta + \sin 3\theta = \sin 2\theta(2\cos\theta + 1).

Example 2

In any triangle ABC, prove that sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}.

Solution:

Consider the left-hand side:

sinA+sinB+sinC=2sin(A+B2)cos(AB2)+sinC\sin A + \sin B + \sin C = 2\sin\left(\frac{A + B}{2}\right)\cos\left(\frac{A - B}{2}\right) + \sin C

Since A+B+C=180A + B + C = 180^\circ, then A+B2=90C2\frac{A + B}{2} = 90^\circ - \frac{C}{2}, and sin(A+B2)=cos(C2)\sin\left(\frac{A+B}{2}\right) = \cos\left(\frac{C}{2}\right)

=2cosC2cos(AB2)+2sinC2cosC2= 2\cos\frac{C}{2}\cos\left(\frac{A - B}{2}\right) + 2\sin\frac{C}{2}\cos\frac{C}{2}

=2cosC2[cos(AB2)+sinC2]= 2\cos\frac{C}{2}\left[\cos\left(\frac{A - B}{2}\right) + \sin\frac{C}{2}\right]

=2cosC2[cos(AB2)+cos(A+B2)]= 2\cos\frac{C}{2}\left[\cos\left(\frac{A - B}{2}\right) + \cos\left(\frac{A+B}{2}\right)\right]

=2cosC2[2cos(AB2+A+B22)cos(AB2A+B22)]= 2\cos\frac{C}{2}\left[2\cos\left(\frac{\frac{A-B}{2} + \frac{A+B}{2}}{2}\right)\cos\left(\frac{\frac{A-B}{2} - \frac{A+B}{2}}{2}\right)\right]

=4cosC2cosA2cosB2= 4\cos\frac{C}{2}\cos\frac{A}{2}\cos\frac{-B}{2}

=4cosA2cosB2cosC2= 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}

Therefore, sinA+sinB+sinC=4cosA2cosB2cosC2\sin A + \sin B + \sin C = 4\cos\frac{A}{2}\cos\frac{B}{2}\cos\frac{C}{2}.

Example 3

Use the t-formulae to find the general solution of the equation 2cosxsinx=12\cos x - \sin x = 1, giving the answers in radians.

Solution:

Using the t-formulae, where t=tanx2t = \tan\frac{x}{2}:

2(1t21+t2)2t1+t2=12\left(\frac{1 - t^2}{1 + t^2}\right) - \frac{2t}{1 + t^2} = 1

22t22t=1+t22 - 2t^2 - 2t = 1 + t^2

3t2+2t1=03t^2 + 2t - 1 = 0

(3t1)(t+1)=0(3t - 1)(t + 1) = 0

t=13 or t=1t = \frac{1}{3} \text{ or } t = -1

Case 1: tanx2=13\tan\frac{x}{2} = \frac{1}{3}

x2=arctan(13)+nπ, where n is an integer.\frac{x}{2} = \arctan\left(\frac{1}{3}\right) + n\pi, \text{ where } n \text{ is an integer.}

x=2arctan(13)+2nπ0.6435+2nπx = 2\arctan\left(\frac{1}{3}\right) + 2n\pi \approx 0.6435 + 2n\pi

Case 2: tanx2=1\tan\frac{x}{2} = -1

x2=π4+nπ, where n is an integer.\frac{x}{2} = -\frac{\pi}{4} + n\pi, \text{ where } n \text{ is an integer.}

x=π2+2nπx = -\frac{\pi}{2} + 2n\pi

Therefore, the general solutions are x0.6435+2nπx \approx 0.6435 + 2n\pi and x=π2+2nπx = -\frac{\pi}{2} + 2n\pi, where nn is an integer.

To be more explicit and cover all possible solutions within a given range (e.g., 0 to 2π2\pi), you would substitute integer values for n. For instance:

For Case 1:

  • If n = 0: x0.6435x \approx 0.6435
  • If n = 1: x0.6435+2π6.9267x \approx 0.6435 + 2\pi \approx 6.9267 (This is outside the range 0 to 2π2\pi, so we generally don't include it unless the range is specified differently.)

For Case 2:

  • If n = 0: x=π21.5708x = -\frac{\pi}{2} \approx -1.5708 (This is outside the standard 0 to 2π2\pi range. To get the equivalent within that range, add 2π2\pi: 1.5708+2π4.7124-1.5708 + 2\pi \approx 4.7124)
  • If n = 1: x=π2+2π=3π24.7124x = -\frac{\pi}{2} + 2\pi = \frac{3\pi}{2} \approx 4.7124

So, within the range 0 to 2π2\pi, the solutions are approximately 0.6435 and 4.7124 radians.

Example 4

Simplify sinθ+sin3θ+sin5θcosθ+cos3θ+cos5θ\frac{\sin\theta + \sin 3\theta + \sin 5\theta}{\cos\theta + \cos 3\theta + \cos 5\theta}.

Solution:

sinθ+sin3θ+sin5θcosθ+cos3θ+cos5θ=(sin5θ+sinθ)+sin3θ(cos5θ+cosθ)+cos3θ\frac{\sin\theta + \sin 3\theta + \sin 5\theta}{\cos\theta + \cos 3\theta + \cos 5\theta} = \frac{(\sin 5\theta + \sin\theta) + \sin 3\theta}{(\cos 5\theta + \cos\theta) + \cos 3\theta}

=2sin(5θ+θ2)cos(5θθ2)+sin3θ2cos(5θ+θ2)cos(5θθ2)+cos3θ= \frac{2\sin\left(\frac{5\theta + \theta}{2}\right)\cos\left(\frac{5\theta - \theta}{2}\right) + \sin 3\theta}{2\cos\left(\frac{5\theta + \theta}{2}\right)\cos\left(\frac{5\theta - \theta}{2}\right) + \cos 3\theta}

=2sin3θcos2θ+sin3θ2cos3θcos2θ+cos3θ= \frac{2\sin 3\theta \cos 2\theta + \sin 3\theta}{2\cos 3\theta \cos 2\theta + \cos 3\theta}

=sin3θ(2cos2θ+1)cos3θ(2cos2θ+1)= \frac{\sin 3\theta(2\cos 2\theta + 1)}{\cos 3\theta(2\cos 2\theta + 1)}

=sin3θcos3θ= \frac{\sin 3\theta}{\cos 3\theta}

=tan3θ= \tan 3\theta

Example 5

Simplify tan(AB2)+tan(A+B2)1tan(AB2)tan(A+B2)\frac{\tan\left(\frac{A - B}{2}\right) + \tan\left(\frac{A + B}{2}\right)}{1 - \tan\left(\frac{A - B}{2}\right)\tan\left(\frac{A + B}{2}\right)}.

Solution:

Using the tangent addition formula: tan(x+y)=tanx+tany1tanxtany\tan(x + y) = \frac{\tan x + \tan y}{1 - \tan x \tan y}

Let x=AB2x = \frac{A - B}{2} and y=A+B2y = \frac{A + B}{2}

Then x+y=AB2+A+B2=Ax + y = \frac{A - B}{2} + \frac{A + B}{2} = A

So, the given expression becomes:

tan(AB2+A+B2)=tanA\tan\left(\frac{A - B}{2} + \frac{A + B}{2}\right) = \tan A

Example 6

Solve the equation cos5x+cosx=cos3x\cos 5x + \cos x = \cos 3x for 0xπ0 \le x \le \pi, giving the answer in terms of π\pi.

Solution:

cos5x+cosx=cos3x\cos 5x + \cos x = \cos 3x

2cos(5x+x2)cos(5xx2)=cos3x2\cos\left(\frac{5x + x}{2}\right)\cos\left(\frac{5x - x}{2}\right) = \cos 3x

2cos3xcos2x=cos3x2\cos 3x \cos 2x = \cos 3x

2cos3xcos2xcos3x=02\cos 3x \cos 2x - \cos 3x = 0

cos3x(2cos2x1)=0\cos 3x(2\cos 2x - 1) = 0

Case 1: cos3x=0\cos 3x = 0

3x=π2,3π2,5π23x = \frac{\pi}{2}, \frac{3\pi}{2}, \frac{5\pi}{2}

x=π6,π2,5π6x = \frac{\pi}{6}, \frac{\pi}{2}, \frac{5\pi}{6}

Case 2: 2cos2x1=02\cos 2x - 1 = 0

cos2x=12\cos 2x = \frac{1}{2}

2x=π3,5π32x = \frac{\pi}{3}, \frac{5\pi}{3}

x=π6,5π6x = \frac{\pi}{6}, \frac{5\pi}{6}

Combining the solutions, we have x=π6,π2,5π6x = \frac{\pi}{6}, \frac{\pi}{2}, \frac{5\pi}{6}.

Mwalimu

Unasoma somo hili? Niulize nikuelezee chochote kilichomo.

Ingia ili kumuuliza Mwalimu wa AI wa Sonza kuhusu mada hii.

Ingia ili kuuliza